C24H26N2O4S — CID 55705690
N-[3-(benzenesulfonamido)-4-methylphenyl]-4-butoxybenzamide (PubChem CID 55705690) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is N-[3-(benzenesulfonamido)-4-methylphenyl]-4-butoxybenzamide.
| Compound Name | N-[3-(benzenesulfonamido)-4-methylphenyl]-4-butoxybenzamide |
|---|---|
| PubChem CID | 55705690 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-[3-(benzenesulfonamido)-4-methylphenyl]-4-butoxybenzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(C)c(NS(=O)(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C24H26N2O4S/c1-3-4-16-30-21-14-11-19(12-15-21)24(27)25-20-13-10-18(2)23(17-20)26-31(28,29)22-8-6-5-7-9-22/h5-15,17,26H,3-4,16H2,1-2H3,(H,25,27) |
| InChIKey | MLFZBLUIMIQZQW-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|