C25H26N2O5S — CID 55705614
N-[3-(benzenesulfonamido)-4-methylphenyl]-4-(oxolan-2-ylmethoxy)benzamide (PubChem CID 55705614) has the molecular formula C25H26N2O5S and a molecular weight of 466.56 g/mol. Its IUPAC name is N-[3-(benzenesulfonamido)-4-methylphenyl]-4-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | N-[3-(benzenesulfonamido)-4-methylphenyl]-4-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 55705614 |
| Molecular Formula | C25H26N2O5S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | N-[3-(benzenesulfonamido)-4-methylphenyl]-4-(oxolan-2-ylmethoxy)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(OCC3CCCO3)cc2)cc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H26N2O5S/c1-18-9-12-20(16-24(18)27-33(29,30)23-7-3-2-4-8-23)26-25(28)19-10-13-21(14-11-19)32-17-22-6-5-15-31-22/h2-4,7-14,16,22,27H,5-6,15,17H2,1H3,(H,26,28) |
| InChIKey | AMJMRHZWSQCIGI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |