C24H23FN2O5S — CID 42910606
N-[3-[(2-fluorophenyl)sulfamoyl]phenyl]-4-(oxolan-2-ylmethoxy)benzamide (PubChem CID 42910606) has the molecular formula C24H23FN2O5S and a molecular weight of 470.52 g/mol. Its IUPAC name is N-[3-[(2-fluorophenyl)sulfamoyl]phenyl]-4-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | N-[3-[(2-fluorophenyl)sulfamoyl]phenyl]-4-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 42910606 |
| Molecular Formula | C24H23FN2O5S |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | N-[3-[(2-fluorophenyl)sulfamoyl]phenyl]-4-(oxolan-2-ylmethoxy)benzamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)Nc2ccccc2F)c1)c1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C24H23FN2O5S/c25-22-8-1-2-9-23(22)27-33(29,30)21-7-3-5-18(15-21)26-24(28)17-10-12-19(13-11-17)32-16-20-6-4-14-31-20/h1-3,5,7-13,15,20,27H,4,6,14,16H2,(H,26,28) |
| InChIKey | GKTALORJIOOXIA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |