C18H20FN3O3S2 — CID 8614308
1-[3-[(2-fluorophenyl)sulfamoyl]phenyl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 8614308) has the molecular formula C18H20FN3O3S2 and a molecular weight of 409.51 g/mol. Its IUPAC name is 1-[3-[(2-fluorophenyl)sulfamoyl]phenyl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[3-[(2-fluorophenyl)sulfamoyl]phenyl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 8614308 |
| Molecular Formula | C18H20FN3O3S2 |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 1-[3-[(2-fluorophenyl)sulfamoyl]phenyl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | O=S(=O)(Nc1ccccc1F)c1cccc(NC(=S)NC[C@@H]2CCCO2)c1 |
| InChI | InChI=1S/C18H20FN3O3S2/c19-16-8-1-2-9-17(16)22-27(23,24)15-7-3-5-13(11-15)21-18(26)20-12-14-6-4-10-25-14/h1-3,5,7-9,11,14,22H,4,6,10,12H2,(H2,20,21,26)/t14-/m0/s1 |
| InChIKey | RFTPWPDVNFVYIH-AWEZNQCLSA-N |
| XLogP | 3.09 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|