C13H15F3N2OS — CID 883340
1-[[(2R)-oxolan-2-yl]methyl]-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 883340) has the molecular formula C13H15F3N2OS and a molecular weight of 304.34 g/mol. Its IUPAC name is 1-[[(2R)-oxolan-2-yl]methyl]-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[[(2R)-oxolan-2-yl]methyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 883340 |
| Molecular Formula | C13H15F3N2OS |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 1-[[(2R)-oxolan-2-yl]methyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | FC(F)(F)c1cccc(NC(=S)NC[C@H]2CCCO2)c1 |
| InChI | InChI=1S/C13H15F3N2OS/c14-13(15,16)9-3-1-4-10(7-9)18-12(20)17-8-11-5-2-6-19-11/h1,3-4,7,11H,2,5-6,8H2,(H2,17,18,20)/t11-/m1/s1 |
| InChIKey | MQSCHCHOEMPIJL-LLVKDONJSA-N |
| XLogP | 3.17 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|