C13H14ClF3N2OS — CID 51389949
1-[4-chloro-2-(trifluoromethyl)phenyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 51389949) has the molecular formula C13H14ClF3N2OS and a molecular weight of 338.78 g/mol. Its IUPAC name is 1-[4-chloro-2-(trifluoromethyl)phenyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 51389949 |
| Molecular Formula | C13H14ClF3N2OS |
| Molecular Weight | 338.78 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | FC(F)(F)c1cc(Cl)ccc1NC(=S)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C13H14ClF3N2OS/c14-8-3-4-11(10(6-8)13(15,16)17)19-12(21)18-7-9-2-1-5-20-9/h3-4,6,9H,1-2,5,7H2,(H2,18,19,21)/t9-/m1/s1 |
| InChIKey | XCXUDSKHTAODQZ-SECBINFHSA-N |
| XLogP | 3.82 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.78 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|