C20H19Cl2F3N2OS — CID 28985166
1-[(2-chlorophenyl)methyl]-3-[4-chloro-2-(trifluoromethyl)phenyl]-1-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 28985166) has the molecular formula C20H19Cl2F3N2OS and a molecular weight of 463.35 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3-[4-chloro-2-(trifluoromethyl)phenyl]-1-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3-[4-chloro-2-(trifluoromethyl)phenyl]-1-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 28985166 |
| Molecular Formula | C20H19Cl2F3N2OS |
| Molecular Weight | 463.35 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3-[4-chloro-2-(trifluoromethyl)phenyl]-1-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | FC(F)(F)c1cc(Cl)ccc1NC(=S)N(Cc1ccccc1Cl)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C20H19Cl2F3N2OS/c21-14-7-8-18(16(10-14)20(23,24)25)26-19(29)27(12-15-5-3-9-28-15)11-13-4-1-2-6-17(13)22/h1-2,4,6-8,10,15H,3,5,9,11-12H2,(H,26,29)/t15-/m0/s1 |
| InChIKey | XPMSNLVHJIZEGM-HNNXBMFYSA-N |
| XLogP | 6.39 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.35 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|