C20H21Cl2FN2OS — CID 28924849
1-[(2-chloro-6-fluorophenyl)methyl]-3-(2-chloro-3-methylphenyl)-1-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 28924849) has the molecular formula C20H21Cl2FN2OS and a molecular weight of 427.37 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl]-3-(2-chloro-3-methylphenyl)-1-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl]-3-(2-chloro-3-methylphenyl)-1-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 28924849 |
| Molecular Formula | C20H21Cl2FN2OS |
| Molecular Weight | 427.37 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl]-3-(2-chloro-3-methylphenyl)-1-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | Cc1cccc(NC(=S)N(Cc2c(F)cccc2Cl)C[C@@H]2CCCO2)c1Cl |
| InChI | InChI=1S/C20H21Cl2FN2OS/c1-13-5-2-9-18(19(13)22)24-20(27)25(11-14-6-4-10-26-14)12-15-16(21)7-3-8-17(15)23/h2-3,5,7-9,14H,4,6,10-12H2,1H3,(H,24,27)/t14-/m0/s1 |
| InChIKey | SGMPACYGWMEWPM-AWEZNQCLSA-N |
| XLogP | 5.82 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.37 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|