C20H22ClFN2OS — CID 49313637
3-(3-chloro-4-methylphenyl)-1-[(3-fluorophenyl)methyl]-1-(oxolan-2-ylmethyl)thiourea (PubChem CID 49313637) has the molecular formula C20H22ClFN2OS and a molecular weight of 392.93 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-1-[(3-fluorophenyl)methyl]-1-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 3-(3-chloro-4-methylphenyl)-1-[(3-fluorophenyl)methyl]-1-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 49313637 |
| Molecular Formula | C20H22ClFN2OS |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-1-[(3-fluorophenyl)methyl]-1-(oxolan-2-ylmethyl)thiourea |
| SMILES | Cc1ccc(NC(=S)N(Cc2cccc(F)c2)CC2CCCO2)cc1Cl |
| InChI | InChI=1S/C20H22ClFN2OS/c1-14-7-8-17(11-19(14)21)23-20(26)24(13-18-6-3-9-25-18)12-15-4-2-5-16(22)10-15/h2,4-5,7-8,10-11,18H,3,6,9,12-13H2,1H3,(H,23,26) |
| InChIKey | GYKQZNUBHPFKGV-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|