C19H22ClN3OS — CID 17387841
3-(4-chloro-3-methylphenyl)-1-(oxolan-2-ylmethyl)-1-(pyridin-2-ylmethyl)thiourea (PubChem CID 17387841) has the molecular formula C19H22ClN3OS and a molecular weight of 375.93 g/mol. Its IUPAC name is 3-(4-chloro-3-methylphenyl)-1-(oxolan-2-ylmethyl)-1-(pyridin-2-ylmethyl)thiourea.
| Compound Name | 3-(4-chloro-3-methylphenyl)-1-(oxolan-2-ylmethyl)-1-(pyridin-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 17387841 |
| Molecular Formula | C19H22ClN3OS |
| Molecular Weight | 375.93 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 3-(4-chloro-3-methylphenyl)-1-(oxolan-2-ylmethyl)-1-(pyridin-2-ylmethyl)thiourea |
| SMILES | Cc1cc(NC(=S)N(Cc2ccccn2)CC2CCCO2)ccc1Cl |
| InChI | InChI=1S/C19H22ClN3OS/c1-14-11-15(7-8-18(14)20)22-19(25)23(13-17-6-4-10-24-17)12-16-5-2-3-9-21-16/h2-3,5,7-9,11,17H,4,6,10,12-13H2,1H3,(H,22,25) |
| InChIKey | YHDSWLMGCXENFC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.93 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|