C24H33N3O3S — CID 28702420
3-[2-(3,4-diethoxyphenyl)ethyl]-1-[[(2R)-oxolan-2-yl]methyl]-1-(pyridin-2-ylmethyl)thiourea (PubChem CID 28702420) has the molecular formula C24H33N3O3S and a molecular weight of 443.61 g/mol. Its IUPAC name is 3-[2-(3,4-diethoxyphenyl)ethyl]-1-[[(2R)-oxolan-2-yl]methyl]-1-(pyridin-2-ylmethyl)thiourea.
| Compound Name | 3-[2-(3,4-diethoxyphenyl)ethyl]-1-[[(2R)-oxolan-2-yl]methyl]-1-(pyridin-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 28702420 |
| Molecular Formula | C24H33N3O3S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 3-[2-(3,4-diethoxyphenyl)ethyl]-1-[[(2R)-oxolan-2-yl]methyl]-1-(pyridin-2-ylmethyl)thiourea |
| SMILES | CCOc1ccc(CCNC(=S)N(Cc2ccccn2)C[C@H]2CCCO2)cc1OCC |
| InChI | InChI=1S/C24H33N3O3S/c1-3-28-22-11-10-19(16-23(22)29-4-2)12-14-26-24(31)27(18-21-9-7-15-30-21)17-20-8-5-6-13-25-20/h5-6,8,10-11,13,16,21H,3-4,7,9,12,14-15,17-18H2,1-2H3,(H,26,31)/t21-/m1/s1 |
| InChIKey | JHWZDYAZZDTECK-OAQYLSRUSA-N |
| XLogP | 3.98 |
| TPSA | 55.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|