C26H31N3O2S — CID 17368862
1-benzyl-3-[2-(3,4-diethoxyphenyl)ethyl]-1-(pyridin-2-ylmethyl)thiourea (PubChem CID 17368862) has the molecular formula C26H31N3O2S and a molecular weight of 449.62 g/mol. Its IUPAC name is 1-benzyl-3-[2-(3,4-diethoxyphenyl)ethyl]-1-(pyridin-2-ylmethyl)thiourea.
| Compound Name | 1-benzyl-3-[2-(3,4-diethoxyphenyl)ethyl]-1-(pyridin-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 17368862 |
| Molecular Formula | C26H31N3O2S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 1-benzyl-3-[2-(3,4-diethoxyphenyl)ethyl]-1-(pyridin-2-ylmethyl)thiourea |
| SMILES | CCOc1ccc(CCNC(=S)N(Cc2ccccc2)Cc2ccccn2)cc1OCC |
| InChI | InChI=1S/C26H31N3O2S/c1-3-30-24-14-13-21(18-25(24)31-4-2)15-17-28-26(32)29(19-22-10-6-5-7-11-22)20-23-12-8-9-16-27-23/h5-14,16,18H,3-4,15,17,19-20H2,1-2H3,(H,28,32) |
| InChIKey | KQWXGGSDKMLAKG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|