C15H22N2O3 — CID 108909248
1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethenylurea (PubChem CID 108909248) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethenylurea.
| Compound Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethenylurea |
|---|---|
| PubChem CID | 108909248 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethenylurea |
| SMILES | C=CNC(=O)NCCc1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C15H22N2O3/c1-4-16-15(18)17-10-9-12-7-8-13(19-5-2)14(11-12)20-6-3/h4,7-8,11H,1,5-6,9-10H2,2-3H3,(H2,16,17,18) |
| InChIKey | HRYQTSBSHKISEX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |