C22H28N2O3 — CID 108905537
1-[2-(3,4-diethoxyphenyl)ethyl]-3-[(E)-2-(3-methylphenyl)ethenyl]urea (PubChem CID 108905537) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[(E)-2-(3-methylphenyl)ethenyl]urea.
| Compound Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[(E)-2-(3-methylphenyl)ethenyl]urea |
|---|---|
| PubChem CID | 108905537 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[(E)-2-(3-methylphenyl)ethenyl]urea |
| SMILES | CCOc1ccc(CCNC(=O)N/C=C/c2cccc(C)c2)cc1OCC |
| InChI | InChI=1S/C22H28N2O3/c1-4-26-20-10-9-19(16-21(20)27-5-2)12-14-24-22(25)23-13-11-18-8-6-7-17(3)15-18/h6-11,13,15-16H,4-5,12,14H2,1-3H3,(H2,23,24,25)/b13-11+ |
| InChIKey | MPYQBBVGLFXVKN-ACCUITESSA-N |
| XLogP | 4.31 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |