C15H24N2O4 — CID 108893630
1-[2-(3,4-diethoxyphenyl)ethyl]-3-(methoxymethyl)urea (PubChem CID 108893630) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 1-[2-(3,4-diethoxyphenyl)ethyl]-3-(methoxymethyl)urea.
| Compound Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-(methoxymethyl)urea |
|---|---|
| PubChem CID | 108893630 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-(methoxymethyl)urea |
| SMILES | CCOc1ccc(CCNC(=O)NCOC)cc1OCC |
| InChI | InChI=1S/C15H24N2O4/c1-4-20-13-7-6-12(10-14(13)21-5-2)8-9-16-15(18)17-11-19-3/h6-7,10H,4-5,8-9,11H2,1-3H3,(H2,16,17,18) |
| InChIKey | RLERTKBVRLOYNB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|