C22H29ClN2O4 — CID 108878076
1-[(4-chloro-3,5-dimethylphenoxy)methyl]-3-[2-(3,4-diethoxyphenyl)ethyl]urea (PubChem CID 108878076) has the molecular formula C22H29ClN2O4 and a molecular weight of 420.94 g/mol. Its IUPAC name is 1-[(4-chloro-3,5-dimethylphenoxy)methyl]-3-[2-(3,4-diethoxyphenyl)ethyl]urea.
| Compound Name | 1-[(4-chloro-3,5-dimethylphenoxy)methyl]-3-[2-(3,4-diethoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 108878076 |
| Molecular Formula | C22H29ClN2O4 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 1-[(4-chloro-3,5-dimethylphenoxy)methyl]-3-[2-(3,4-diethoxyphenyl)ethyl]urea |
| SMILES | CCOc1ccc(CCNC(=O)NCOc2cc(C)c(Cl)c(C)c2)cc1OCC |
| InChI | InChI=1S/C22H29ClN2O4/c1-5-27-19-8-7-17(13-20(19)28-6-2)9-10-24-22(26)25-14-29-18-11-15(3)21(23)16(4)12-18/h7-8,11-13H,5-6,9-10,14H2,1-4H3,(H2,24,25,26) |
| InChIKey | IAEDYWQGVKYNNT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|