C19H24N2O4 — CID 108871526
1-[2-(3,4-diethoxyphenyl)ethyl]-3-(2-hydroxyphenyl)urea (PubChem CID 108871526) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 1-[2-(3,4-diethoxyphenyl)ethyl]-3-(2-hydroxyphenyl)urea.
| Compound Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-(2-hydroxyphenyl)urea |
|---|---|
| PubChem CID | 108871526 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-(2-hydroxyphenyl)urea |
| SMILES | CCOc1ccc(CCNC(=O)Nc2ccccc2O)cc1OCC |
| InChI | InChI=1S/C19H24N2O4/c1-3-24-17-10-9-14(13-18(17)25-4-2)11-12-20-19(23)21-15-7-5-6-8-16(15)22/h5-10,13,22H,3-4,11-12H2,1-2H3,(H2,20,21,23) |
| InChIKey | ZOLPFQSDAIHFGY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|