C24H32N2O4 — CID 1312332
N-[2-(3,4-diethoxyphenyl)ethyl]-2-(2,2-dimethylpropanoylamino)benzamide (PubChem CID 1312332) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-2-(2,2-dimethylpropanoylamino)benzamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-(2,2-dimethylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 1312332 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-(2,2-dimethylpropanoylamino)benzamide |
| SMILES | CCOc1ccc(CCNC(=O)c2ccccc2NC(=O)C(C)(C)C)cc1OCC |
| InChI | InChI=1S/C24H32N2O4/c1-6-29-20-13-12-17(16-21(20)30-7-2)14-15-25-22(27)18-10-8-9-11-19(18)26-23(28)24(3,4)5/h8-13,16H,6-7,14-15H2,1-5H3,(H,25,27)(H,26,28) |
| InChIKey | WYRHHOOBUAUEKU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |