C23H26N2O3 — CID 86945247
2-(2,2-dimethylpropanoylamino)-N-[2-(4-prop-2-ynoxyphenyl)ethyl]benzamide (PubChem CID 86945247) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoylamino)-N-[2-(4-prop-2-ynoxyphenyl)ethyl]benzamide.
| Compound Name | 2-(2,2-dimethylpropanoylamino)-N-[2-(4-prop-2-ynoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 86945247 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 2-(2,2-dimethylpropanoylamino)-N-[2-(4-prop-2-ynoxyphenyl)ethyl]benzamide |
| SMILES | C#CCOc1ccc(CCNC(=O)c2ccccc2NC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H26N2O3/c1-5-16-28-18-12-10-17(11-13-18)14-15-24-21(26)19-8-6-7-9-20(19)25-22(27)23(2,3)4/h1,6-13H,14-16H2,2-4H3,(H,24,26)(H,25,27) |
| InChIKey | IKUAFFYQUVAPRR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|