C18H22N4O2S — CID 86875421
1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-3-[2-(4-prop-2-ynoxyphenyl)ethyl]urea (PubChem CID 86875421) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-3-[2-(4-prop-2-ynoxyphenyl)ethyl]urea.
| Compound Name | 1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-3-[2-(4-prop-2-ynoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 86875421 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-3-[2-(4-prop-2-ynoxyphenyl)ethyl]urea |
| SMILES | C#CCOc1ccc(CCNC(=O)Nc2nnc(C(C)(C)C)s2)cc1 |
| InChI | InChI=1S/C18H22N4O2S/c1-5-12-24-14-8-6-13(7-9-14)10-11-19-16(23)20-17-22-21-15(25-17)18(2,3)4/h1,6-9H,10-12H2,2-4H3,(H2,19,20,22,23) |
| InChIKey | HOJWUKCIKXAJJT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|