C20H22N2O3 — CID 86875415
1-(2-methoxy-4-methylphenyl)-3-[2-(4-prop-2-ynoxyphenyl)ethyl]urea (PubChem CID 86875415) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-(2-methoxy-4-methylphenyl)-3-[2-(4-prop-2-ynoxyphenyl)ethyl]urea.
| Compound Name | 1-(2-methoxy-4-methylphenyl)-3-[2-(4-prop-2-ynoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 86875415 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-(2-methoxy-4-methylphenyl)-3-[2-(4-prop-2-ynoxyphenyl)ethyl]urea |
| SMILES | C#CCOc1ccc(CCNC(=O)Nc2ccc(C)cc2OC)cc1 |
| InChI | InChI=1S/C20H22N2O3/c1-4-13-25-17-8-6-16(7-9-17)11-12-21-20(23)22-18-10-5-15(2)14-19(18)24-3/h1,5-10,14H,11-13H2,2-3H3,(H2,21,22,23) |
| InChIKey | FGUMKQOSDAEIJR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|