C17H20N2O2 — CID 727799
1-[2-(4-methoxyphenyl)ethyl]-3-(4-methylphenyl)urea (PubChem CID 727799) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)ethyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[2-(4-methoxyphenyl)ethyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 727799 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)ethyl]-3-(4-methylphenyl)urea |
| SMILES | COc1ccc(CCNC(=O)Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C17H20N2O2/c1-13-3-7-15(8-4-13)19-17(20)18-12-11-14-5-9-16(21-2)10-6-14/h3-10H,11-12H2,1-2H3,(H2,18,19,20) |
| InChIKey | KHVFZEUFXGCJIX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |