C17H17F3N2O2 — CID 108896191
1-[2-(4-methoxyphenyl)ethyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 108896191) has the molecular formula C17H17F3N2O2 and a molecular weight of 338.33 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)ethyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-(4-methoxyphenyl)ethyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 108896191 |
| Molecular Formula | C17H17F3N2O2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)ethyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | COc1ccc(CCNC(=O)Nc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H17F3N2O2/c1-24-15-8-2-12(3-9-15)10-11-21-16(23)22-14-6-4-13(5-7-14)17(18,19)20/h2-9H,10-11H2,1H3,(H2,21,22,23) |
| InChIKey | DIBJSLSSTRVWTC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |