C20H22F3N3O3 — CID 47984901
N-(4-ethoxyphenyl)-2-[2-[4-(trifluoromethyl)phenyl]ethylcarbamoylamino]acetamide (PubChem CID 47984901) has the molecular formula C20H22F3N3O3 and a molecular weight of 409.41 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[2-[4-(trifluoromethyl)phenyl]ethylcarbamoylamino]acetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[2-[4-(trifluoromethyl)phenyl]ethylcarbamoylamino]acetamide |
|---|---|
| PubChem CID | 47984901 |
| Molecular Formula | C20H22F3N3O3 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[2-[4-(trifluoromethyl)phenyl]ethylcarbamoylamino]acetamide |
| SMILES | CCOc1ccc(NC(=O)CNC(=O)NCCc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H22F3N3O3/c1-2-29-17-9-7-16(8-10-17)26-18(27)13-25-19(28)24-12-11-14-3-5-15(6-4-14)20(21,22)23/h3-10H,2,11-13H2,1H3,(H,26,27)(H2,24,25,28) |
| InChIKey | JEYBMWKIWFWIAB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |