C18H20FN3O3 — CID 18160151
N-(4-ethoxyphenyl)-2-[(4-fluorophenyl)methylcarbamoylamino]acetamide (PubChem CID 18160151) has the molecular formula C18H20FN3O3 and a molecular weight of 345.37 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[(4-fluorophenyl)methylcarbamoylamino]acetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[(4-fluorophenyl)methylcarbamoylamino]acetamide |
|---|---|
| PubChem CID | 18160151 |
| Molecular Formula | C18H20FN3O3 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[(4-fluorophenyl)methylcarbamoylamino]acetamide |
| SMILES | CCOc1ccc(NC(=O)CNC(=O)NCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H20FN3O3/c1-2-25-16-9-7-15(8-10-16)22-17(23)12-21-18(24)20-11-13-3-5-14(19)6-4-13/h3-10H,2,11-12H2,1H3,(H,22,23)(H2,20,21,24) |
| InChIKey | LZSPHMNWCZTVQK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |