C19H21FN4O3 — CID 86923315
2-[4-[[2-[(4-fluorophenyl)methylcarbamoylamino]acetyl]amino]phenyl]-N-methylacetamide (PubChem CID 86923315) has the molecular formula C19H21FN4O3 and a molecular weight of 372.40 g/mol. Its IUPAC name is 2-[4-[[2-[(4-fluorophenyl)methylcarbamoylamino]acetyl]amino]phenyl]-N-methylacetamide.
| Compound Name | 2-[4-[[2-[(4-fluorophenyl)methylcarbamoylamino]acetyl]amino]phenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 86923315 |
| Molecular Formula | C19H21FN4O3 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2-[4-[[2-[(4-fluorophenyl)methylcarbamoylamino]acetyl]amino]phenyl]-N-methylacetamide |
| SMILES | CNC(=O)Cc1ccc(NC(=O)CNC(=O)NCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H21FN4O3/c1-21-17(25)10-13-4-8-16(9-5-13)24-18(26)12-23-19(27)22-11-14-2-6-15(20)7-3-14/h2-9H,10-12H2,1H3,(H,21,25)(H,24,26)(H2,22,23,27) |
| InChIKey | NANJFEUNXVCLFY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |