C22H21FN4O4S — CID 24638119
2-[(4-fluorophenyl)methylcarbamoylamino]-N-[4-(phenylsulfamoyl)phenyl]acetamide (PubChem CID 24638119) has the molecular formula C22H21FN4O4S and a molecular weight of 456.50 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylcarbamoylamino]-N-[4-(phenylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[(4-fluorophenyl)methylcarbamoylamino]-N-[4-(phenylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 24638119 |
| Molecular Formula | C22H21FN4O4S |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 2-[(4-fluorophenyl)methylcarbamoylamino]-N-[4-(phenylsulfamoyl)phenyl]acetamide |
| SMILES | O=C(CNC(=O)NCc1ccc(F)cc1)Nc1ccc(S(=O)(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C22H21FN4O4S/c23-17-8-6-16(7-9-17)14-24-22(29)25-15-21(28)26-18-10-12-20(13-11-18)32(30,31)27-19-4-2-1-3-5-19/h1-13,27H,14-15H2,(H,26,28)(H2,24,25,29) |
| InChIKey | IRVLKMIWLRFGMM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |