C21H19FN2O3S — CID 27228794
2-[4-[(4-fluorophenyl)sulfonylamino]phenyl]-N-(4-methylphenyl)acetamide (PubChem CID 27228794) has the molecular formula C21H19FN2O3S and a molecular weight of 398.46 g/mol. Its IUPAC name is 2-[4-[(4-fluorophenyl)sulfonylamino]phenyl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4-[(4-fluorophenyl)sulfonylamino]phenyl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 27228794 |
| Molecular Formula | C21H19FN2O3S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 2-[4-[(4-fluorophenyl)sulfonylamino]phenyl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cc2ccc(NS(=O)(=O)c3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C21H19FN2O3S/c1-15-2-8-18(9-3-15)23-21(25)14-16-4-10-19(11-5-16)24-28(26,27)20-12-6-17(22)7-13-20/h2-13,24H,14H2,1H3,(H,23,25) |
| InChIKey | QHNCRSBREDGVON-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |