C16H15FN2O4S — CID 3379076
N-[4-(acetylsulfamoyl)phenyl]-2-(4-fluorophenyl)acetamide (PubChem CID 3379076) has the molecular formula C16H15FN2O4S and a molecular weight of 350.37 g/mol. Its IUPAC name is N-[4-(acetylsulfamoyl)phenyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[4-(acetylsulfamoyl)phenyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 3379076 |
| Molecular Formula | C16H15FN2O4S |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | N-[4-(acetylsulfamoyl)phenyl]-2-(4-fluorophenyl)acetamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NC(=O)Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C16H15FN2O4S/c1-11(20)19-24(22,23)15-8-6-14(7-9-15)18-16(21)10-12-2-4-13(17)5-3-12/h2-9H,10H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | OGRZJQLKMSUFFH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |