C15H14FN3O3S2 — CID 25044330
N-[4-[(4-fluorophenyl)carbamothioylamino]phenyl]sulfonylacetamide (PubChem CID 25044330) has the molecular formula C15H14FN3O3S2 and a molecular weight of 367.43 g/mol. Its IUPAC name is N-[4-[(4-fluorophenyl)carbamothioylamino]phenyl]sulfonylacetamide.
| Compound Name | N-[4-[(4-fluorophenyl)carbamothioylamino]phenyl]sulfonylacetamide |
|---|---|
| PubChem CID | 25044330 |
| Molecular Formula | C15H14FN3O3S2 |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | N-[4-[(4-fluorophenyl)carbamothioylamino]phenyl]sulfonylacetamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NC(=S)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C15H14FN3O3S2/c1-10(20)19-24(21,22)14-8-6-13(7-9-14)18-15(23)17-12-4-2-11(16)3-5-12/h2-9H,1H3,(H,19,20)(H2,17,18,23) |
| InChIKey | DVODJLASGXADJW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|