C12H15N3O3S2 — CID 121011371
N-[4-(prop-2-enylcarbamothioylsulfamoyl)phenyl]acetamide (PubChem CID 121011371) has the molecular formula C12H15N3O3S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[4-(prop-2-enylcarbamothioylsulfamoyl)phenyl]acetamide.
| Compound Name | N-[4-(prop-2-enylcarbamothioylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 121011371 |
| Molecular Formula | C12H15N3O3S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | N-[4-(prop-2-enylcarbamothioylsulfamoyl)phenyl]acetamide |
| SMILES | C=CCNC(=S)NS(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C12H15N3O3S2/c1-3-8-13-12(19)15-20(17,18)11-6-4-10(5-7-11)14-9(2)16/h3-7H,1,8H2,2H3,(H,14,16)(H2,13,15,19) |
| InChIKey | NJDCGEICMWCMBA-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|