C23H28N4O8S2 — CID 102513773
N,N'-bis[(4-acetamidophenyl)sulfonyl]heptanediamide (PubChem CID 102513773) has the molecular formula C23H28N4O8S2 and a molecular weight of 552.63 g/mol. Its IUPAC name is N,N'-bis[(4-acetamidophenyl)sulfonyl]heptanediamide.
| Compound Name | N,N'-bis[(4-acetamidophenyl)sulfonyl]heptanediamide |
|---|---|
| PubChem CID | 102513773 |
| Molecular Formula | C23H28N4O8S2 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | N,N'-bis[(4-acetamidophenyl)sulfonyl]heptanediamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NC(=O)CCCCCC(=O)NS(=O)(=O)c2ccc(NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C23H28N4O8S2/c1-16(28)24-18-8-12-20(13-9-18)36(32,33)26-22(30)6-4-3-5-7-23(31)27-37(34,35)21-14-10-19(11-15-21)25-17(2)29/h8-15H,3-7H2,1-2H3,(H,24,28)(H,25,29)(H,26,30)(H,27,31) |
| InChIKey | WKFIXIWVZNOCQC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 184.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|