C26H38N4O6S2 — CID 4992549
N,N'-bis[4-(tert-butylsulfamoyl)phenyl]hexanediamide (PubChem CID 4992549) has the molecular formula C26H38N4O6S2 and a molecular weight of 566.75 g/mol. Its IUPAC name is N,N'-bis[4-(tert-butylsulfamoyl)phenyl]hexanediamide.
| Compound Name | N,N'-bis[4-(tert-butylsulfamoyl)phenyl]hexanediamide |
|---|---|
| PubChem CID | 4992549 |
| Molecular Formula | C26H38N4O6S2 |
| Molecular Weight | 566.75 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | N,N'-bis[4-(tert-butylsulfamoyl)phenyl]hexanediamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(NC(=O)CCCCC(=O)Nc2ccc(S(=O)(=O)NC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H38N4O6S2/c1-25(2,3)29-37(33,34)21-15-11-19(12-16-21)27-23(31)9-7-8-10-24(32)28-20-13-17-22(18-14-20)38(35,36)30-26(4,5)6/h11-18,29-30H,7-10H2,1-6H3,(H,27,31)(H,28,32) |
| InChIKey | DJJOSAOGAPJTPX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.75 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|