C27H36N4O6S2 — CID 4930373
N,N'-bis[4-(prop-2-enylsulfamoyl)phenyl]nonanediamide (PubChem CID 4930373) has the molecular formula C27H36N4O6S2 and a molecular weight of 576.74 g/mol. Its IUPAC name is N,N'-bis[4-(prop-2-enylsulfamoyl)phenyl]nonanediamide.
| Compound Name | N,N'-bis[4-(prop-2-enylsulfamoyl)phenyl]nonanediamide |
|---|---|
| PubChem CID | 4930373 |
| Molecular Formula | C27H36N4O6S2 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | N,N'-bis[4-(prop-2-enylsulfamoyl)phenyl]nonanediamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(NC(=O)CCCCCCCC(=O)Nc2ccc(S(=O)(=O)NCC=C)cc2)cc1 |
| InChI | InChI=1S/C27H36N4O6S2/c1-3-20-28-38(34,35)24-16-12-22(13-17-24)30-26(32)10-8-6-5-7-9-11-27(33)31-23-14-18-25(19-15-23)39(36,37)29-21-4-2/h3-4,12-19,28-29H,1-2,5-11,20-21H2,(H,30,32)(H,31,33) |
| InChIKey | VVDOCFFRSUXUGJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|