C33H44N4O6S2 — CID 4924122
N,N'-bis[4-[bis(prop-2-enyl)sulfamoyl]phenyl]nonanediamide (PubChem CID 4924122) has the molecular formula C33H44N4O6S2 and a molecular weight of 656.87 g/mol. Its IUPAC name is N,N'-bis[4-[bis(prop-2-enyl)sulfamoyl]phenyl]nonanediamide.
| Compound Name | N,N'-bis[4-[bis(prop-2-enyl)sulfamoyl]phenyl]nonanediamide |
|---|---|
| PubChem CID | 4924122 |
| Molecular Formula | C33H44N4O6S2 |
| Molecular Weight | 656.87 g/mol |
| Exact Mass | 656.27 |
| IUPAC Name | N,N'-bis[4-[bis(prop-2-enyl)sulfamoyl]phenyl]nonanediamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(NC(=O)CCCCCCCC(=O)Nc2ccc(S(=O)(=O)N(CC=C)CC=C)cc2)cc1 |
| InChI | InChI=1S/C33H44N4O6S2/c1-5-24-36(25-6-2)44(40,41)30-20-16-28(17-21-30)34-32(38)14-12-10-9-11-13-15-33(39)35-29-18-22-31(23-19-29)45(42,43)37(26-7-3)27-8-4/h5-8,16-23H,1-4,9-15,24-27H2,(H,34,38)(H,35,39) |
| InChIKey | LMOZOPQSLREKAD-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.87 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|