C17H22N2O5S — CID 17097504
ethyl 3-[4-[bis(prop-2-enyl)sulfamoyl]anilino]-3-oxopropanoate (PubChem CID 17097504) has the molecular formula C17H22N2O5S and a molecular weight of 366.44 g/mol. Its IUPAC name is ethyl 3-[4-[bis(prop-2-enyl)sulfamoyl]anilino]-3-oxopropanoate.
| Compound Name | ethyl 3-[4-[bis(prop-2-enyl)sulfamoyl]anilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 17097504 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | ethyl 3-[4-[bis(prop-2-enyl)sulfamoyl]anilino]-3-oxopropanoate |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(NC(=O)CC(=O)OCC)cc1 |
| InChI | InChI=1S/C17H22N2O5S/c1-4-11-19(12-5-2)25(22,23)15-9-7-14(8-10-15)18-16(20)13-17(21)24-6-3/h4-5,7-10H,1-2,6,11-13H2,3H3,(H,18,20) |
| InChIKey | YPAQRCSDNBTRDS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|