C22H24N2O4S — CID 1226881
(E)-N-[4-[bis(prop-2-enyl)sulfamoyl]phenyl]-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 1226881) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is (E)-N-[4-[bis(prop-2-enyl)sulfamoyl]phenyl]-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[bis(prop-2-enyl)sulfamoyl]phenyl]-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 1226881 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (E)-N-[4-[bis(prop-2-enyl)sulfamoyl]phenyl]-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(NC(=O)/C=C/c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H24N2O4S/c1-4-16-24(17-5-2)29(26,27)21-13-9-19(10-14-21)23-22(25)15-8-18-6-11-20(28-3)12-7-18/h4-15H,1-2,16-17H2,3H3,(H,23,25)/b15-8+ |
| InChIKey | JFOGKGNZTTYWGG-OVCLIPMQSA-N |
| XLogP | 3.71 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|