C23H26N2O4S — CID 17227080
(E)-N-[4-[bis(prop-2-enyl)sulfamoyl]phenyl]-3-(4-ethoxyphenyl)prop-2-enamide (PubChem CID 17227080) has the molecular formula C23H26N2O4S and a molecular weight of 426.54 g/mol. Its IUPAC name is (E)-N-[4-[bis(prop-2-enyl)sulfamoyl]phenyl]-3-(4-ethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[bis(prop-2-enyl)sulfamoyl]phenyl]-3-(4-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17227080 |
| Molecular Formula | C23H26N2O4S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | (E)-N-[4-[bis(prop-2-enyl)sulfamoyl]phenyl]-3-(4-ethoxyphenyl)prop-2-enamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(NC(=O)/C=C/c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C23H26N2O4S/c1-4-17-25(18-5-2)30(27,28)22-14-10-20(11-15-22)24-23(26)16-9-19-7-12-21(13-8-19)29-6-3/h4-5,7-16H,1-2,6,17-18H2,3H3,(H,24,26)/b16-9+ |
| InChIKey | APVWWQPBWHFXQY-CXUHLZMHSA-N |
| XLogP | 4.10 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|