C21H25N3O5S — CID 55503201
4-[[2-[(4-methoxyphenyl)sulfonyl-prop-2-enylamino]acetyl]amino]-N,N-dimethylbenzamide (PubChem CID 55503201) has the molecular formula C21H25N3O5S and a molecular weight of 431.51 g/mol. Its IUPAC name is 4-[[2-[(4-methoxyphenyl)sulfonyl-prop-2-enylamino]acetyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 4-[[2-[(4-methoxyphenyl)sulfonyl-prop-2-enylamino]acetyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 55503201 |
| Molecular Formula | C21H25N3O5S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 4-[[2-[(4-methoxyphenyl)sulfonyl-prop-2-enylamino]acetyl]amino]-N,N-dimethylbenzamide |
| SMILES | C=CCN(CC(=O)Nc1ccc(C(=O)N(C)C)cc1)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H25N3O5S/c1-5-14-24(30(27,28)19-12-10-18(29-4)11-13-19)15-20(25)22-17-8-6-16(7-9-17)21(26)23(2)3/h5-13H,1,14-15H2,2-4H3,(H,22,25) |
| InChIKey | MVRVHYVCMVDTIB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|