C22H24Cl2N2O4S — CID 4777944
N-[4-[bis(prop-2-enyl)sulfamoyl]phenyl]-4-(2,4-dichlorophenoxy)butanamide (PubChem CID 4777944) has the molecular formula C22H24Cl2N2O4S and a molecular weight of 483.42 g/mol. Its IUPAC name is N-[4-[bis(prop-2-enyl)sulfamoyl]phenyl]-4-(2,4-dichlorophenoxy)butanamide.
| Compound Name | N-[4-[bis(prop-2-enyl)sulfamoyl]phenyl]-4-(2,4-dichlorophenoxy)butanamide |
|---|---|
| PubChem CID | 4777944 |
| Molecular Formula | C22H24Cl2N2O4S |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | N-[4-[bis(prop-2-enyl)sulfamoyl]phenyl]-4-(2,4-dichlorophenoxy)butanamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(NC(=O)CCCOc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C22H24Cl2N2O4S/c1-3-13-26(14-4-2)31(28,29)19-10-8-18(9-11-19)25-22(27)6-5-15-30-21-12-7-17(23)16-20(21)24/h3-4,7-12,16H,1-2,5-6,13-15H2,(H,25,27) |
| InChIKey | WZLHTYFXBXNYEE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|