C21H25Cl2N3O4S — CID 67990189
N-[4-[amino(cyclopentyl)sulfamoyl]phenyl]-4-(2,4-dichlorophenoxy)butanamide (PubChem CID 67990189) has the molecular formula C21H25Cl2N3O4S and a molecular weight of 486.42 g/mol. Its IUPAC name is N-[4-[amino(cyclopentyl)sulfamoyl]phenyl]-4-(2,4-dichlorophenoxy)butanamide.
| Compound Name | N-[4-[amino(cyclopentyl)sulfamoyl]phenyl]-4-(2,4-dichlorophenoxy)butanamide |
|---|---|
| PubChem CID | 67990189 |
| Molecular Formula | C21H25Cl2N3O4S |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | N-[4-[amino(cyclopentyl)sulfamoyl]phenyl]-4-(2,4-dichlorophenoxy)butanamide |
| SMILES | NN(C1CCCC1)S(=O)(=O)c1ccc(NC(=O)CCCOc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C21H25Cl2N3O4S/c22-15-7-12-20(19(23)14-15)30-13-3-6-21(27)25-16-8-10-18(11-9-16)31(28,29)26(24)17-4-1-2-5-17/h7-12,14,17H,1-6,13,24H2,(H,25,27) |
| InChIKey | AOFHDUYBXSSRKD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|