C20H22Cl2N2O4 — CID 32943275
4-(2,4-dichlorophenoxy)-N-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]butanamide (PubChem CID 32943275) has the molecular formula C20H22Cl2N2O4 and a molecular weight of 425.31 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]butanamide |
|---|---|
| PubChem CID | 32943275 |
| Molecular Formula | C20H22Cl2N2O4 |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]butanamide |
| SMILES | CN(C)C(=O)COc1ccc(NC(=O)CCCOc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C20H22Cl2N2O4/c1-24(2)20(26)13-28-16-8-6-15(7-9-16)23-19(25)4-3-11-27-18-10-5-14(21)12-17(18)22/h5-10,12H,3-4,11,13H2,1-2H3,(H,23,25) |
| InChIKey | KATTZRYLQGSWPE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|