C23H26Cl2N4O5S — CID 4501278
4-[2-[4-(2,4-dichlorophenoxy)butanoylcarbamothioyl]hydrazinyl]-N-(4-ethoxyphenyl)-4-oxobutanamide (PubChem CID 4501278) has the molecular formula C23H26Cl2N4O5S and a molecular weight of 541.46 g/mol. Its IUPAC name is 4-[2-[4-(2,4-dichlorophenoxy)butanoylcarbamothioyl]hydrazinyl]-N-(4-ethoxyphenyl)-4-oxobutanamide.
| Compound Name | 4-[2-[4-(2,4-dichlorophenoxy)butanoylcarbamothioyl]hydrazinyl]-N-(4-ethoxyphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 4501278 |
| Molecular Formula | C23H26Cl2N4O5S |
| Molecular Weight | 541.46 g/mol |
| Exact Mass | 540.10 |
| IUPAC Name | 4-[2-[4-(2,4-dichlorophenoxy)butanoylcarbamothioyl]hydrazinyl]-N-(4-ethoxyphenyl)-4-oxobutanamide |
| SMILES | CCOc1ccc(NC(=O)CCC(=O)NNC(=S)NC(=O)CCCOc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C23H26Cl2N4O5S/c1-2-33-17-8-6-16(7-9-17)26-21(31)11-12-22(32)28-29-23(35)27-20(30)4-3-13-34-19-10-5-15(24)14-18(19)25/h5-10,14H,2-4,11-13H2,1H3,(H,26,31)(H,28,32)(H2,27,29,30,35) |
| InChIKey | NXAZQASKRRIGMJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|