C16H21Cl2N3O3S — CID 4923094
N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]-3-methylbutanamide (PubChem CID 4923094) has the molecular formula C16H21Cl2N3O3S and a molecular weight of 406.34 g/mol. Its IUPAC name is N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]-3-methylbutanamide.
| Compound Name | N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 4923094 |
| Molecular Formula | C16H21Cl2N3O3S |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NC(=S)NNC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H21Cl2N3O3S/c1-10(2)8-15(23)19-16(25)21-20-14(22)4-3-7-24-13-6-5-11(17)9-12(13)18/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,20,22)(H2,19,21,23,25) |
| InChIKey | PLIWCQWOHYPYTH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|