C20H19Cl2N3O3S — CID 6122835
(E)-N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]-3-phenylprop-2-enamide (PubChem CID 6122835) has the molecular formula C20H19Cl2N3O3S and a molecular weight of 452.36 g/mol. Its IUPAC name is (E)-N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 6122835 |
| Molecular Formula | C20H19Cl2N3O3S |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | (E)-N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NC(=S)NNC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H19Cl2N3O3S/c21-15-9-10-17(16(22)13-15)28-12-4-7-19(27)24-25-20(29)23-18(26)11-8-14-5-2-1-3-6-14/h1-3,5-6,8-11,13H,4,7,12H2,(H,24,27)(H2,23,25,26,29)/b11-8+ |
| InChIKey | WSDXYANOPIJACY-DHZHZOJOSA-N |
| XLogP | 3.89 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|