C18H16Cl3N3O3S — CID 4500967
N-[[(3-chlorobenzoyl)amino]carbamothioyl]-4-(2,4-dichlorophenoxy)butanamide (PubChem CID 4500967) has the molecular formula C18H16Cl3N3O3S and a molecular weight of 460.77 g/mol. Its IUPAC name is N-[[(3-chlorobenzoyl)amino]carbamothioyl]-4-(2,4-dichlorophenoxy)butanamide.
| Compound Name | N-[[(3-chlorobenzoyl)amino]carbamothioyl]-4-(2,4-dichlorophenoxy)butanamide |
|---|---|
| PubChem CID | 4500967 |
| Molecular Formula | C18H16Cl3N3O3S |
| Molecular Weight | 460.77 g/mol |
| Exact Mass | 459.00 |
| IUPAC Name | N-[[(3-chlorobenzoyl)amino]carbamothioyl]-4-(2,4-dichlorophenoxy)butanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NC(=S)NNC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H16Cl3N3O3S/c19-12-4-1-3-11(9-12)17(26)23-24-18(28)22-16(25)5-2-8-27-15-7-6-13(20)10-14(15)21/h1,3-4,6-7,9-10H,2,5,8H2,(H,23,26)(H2,22,24,25,28) |
| InChIKey | NUDSOCLLRBBETB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.77 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|