C19H18Cl2IN3O4S — CID 4501147
4-(2,4-dichlorophenoxy)-N-[[(3-iodo-4-methoxybenzoyl)amino]carbamothioyl]butanamide (PubChem CID 4501147) has the molecular formula C19H18Cl2IN3O4S and a molecular weight of 582.25 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-[[(3-iodo-4-methoxybenzoyl)amino]carbamothioyl]butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-[[(3-iodo-4-methoxybenzoyl)amino]carbamothioyl]butanamide |
|---|---|
| PubChem CID | 4501147 |
| Molecular Formula | C19H18Cl2IN3O4S |
| Molecular Weight | 582.25 g/mol |
| Exact Mass | 580.94 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-[[(3-iodo-4-methoxybenzoyl)amino]carbamothioyl]butanamide |
| SMILES | COc1ccc(C(=O)NNC(=S)NC(=O)CCCOc2ccc(Cl)cc2Cl)cc1I |
| InChI | InChI=1S/C19H18Cl2IN3O4S/c1-28-16-6-4-11(9-14(16)22)18(27)24-25-19(30)23-17(26)3-2-8-29-15-7-5-12(20)10-13(15)21/h4-7,9-10H,2-3,8H2,1H3,(H,24,27)(H2,23,25,26,30) |
| InChIKey | CSVZPFVTAZHBHG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.25 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|