C18H18Cl2N2O3 — CID 3270892
N'-[4-(2,4-dichlorophenoxy)butanoyl]-4-methylbenzohydrazide (PubChem CID 3270892) has the molecular formula C18H18Cl2N2O3 and a molecular weight of 381.26 g/mol. Its IUPAC name is N'-[4-(2,4-dichlorophenoxy)butanoyl]-4-methylbenzohydrazide.
| Compound Name | N'-[4-(2,4-dichlorophenoxy)butanoyl]-4-methylbenzohydrazide |
|---|---|
| PubChem CID | 3270892 |
| Molecular Formula | C18H18Cl2N2O3 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | N'-[4-(2,4-dichlorophenoxy)butanoyl]-4-methylbenzohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)CCCOc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H18Cl2N2O3/c1-12-4-6-13(7-5-12)18(24)22-21-17(23)3-2-10-25-16-9-8-14(19)11-15(16)20/h4-9,11H,2-3,10H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | FWAKYQUGFJCYJZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|