C22H26Cl2N2O4 — CID 4935342
N'-[4-(2,4-dichlorophenoxy)butanoyl]-4-pentoxybenzohydrazide (PubChem CID 4935342) has the molecular formula C22H26Cl2N2O4 and a molecular weight of 453.37 g/mol. Its IUPAC name is N'-[4-(2,4-dichlorophenoxy)butanoyl]-4-pentoxybenzohydrazide.
| Compound Name | N'-[4-(2,4-dichlorophenoxy)butanoyl]-4-pentoxybenzohydrazide |
|---|---|
| PubChem CID | 4935342 |
| Molecular Formula | C22H26Cl2N2O4 |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | N'-[4-(2,4-dichlorophenoxy)butanoyl]-4-pentoxybenzohydrazide |
| SMILES | CCCCCOc1ccc(C(=O)NNC(=O)CCCOc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C22H26Cl2N2O4/c1-2-3-4-13-29-18-10-7-16(8-11-18)22(28)26-25-21(27)6-5-14-30-20-12-9-17(23)15-19(20)24/h7-12,15H,2-6,13-14H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | MYFBNPUCIKCPIB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|