C19H20Cl2N2O5 — CID 17112743
N'-[2-(2,4-dichlorophenoxy)acetyl]-4-(2-ethoxyethoxy)benzohydrazide (PubChem CID 17112743) has the molecular formula C19H20Cl2N2O5 and a molecular weight of 427.28 g/mol. Its IUPAC name is N'-[2-(2,4-dichlorophenoxy)acetyl]-4-(2-ethoxyethoxy)benzohydrazide.
| Compound Name | N'-[2-(2,4-dichlorophenoxy)acetyl]-4-(2-ethoxyethoxy)benzohydrazide |
|---|---|
| PubChem CID | 17112743 |
| Molecular Formula | C19H20Cl2N2O5 |
| Molecular Weight | 427.28 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | N'-[2-(2,4-dichlorophenoxy)acetyl]-4-(2-ethoxyethoxy)benzohydrazide |
| SMILES | CCOCCOc1ccc(C(=O)NNC(=O)COc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H20Cl2N2O5/c1-2-26-9-10-27-15-6-3-13(4-7-15)19(25)23-22-18(24)12-28-17-8-5-14(20)11-16(17)21/h3-8,11H,2,9-10,12H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | BEXZUZIJJUIQAD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|